C24H64O8Si6 — CID 160950844
2-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]ethanol;2-prop-2-enoxyethanol;trimethyl-[methyl(trimethylsilyloxy)silyl]oxysilane (PubChem CID 160950844) has the molecular formula C24H64O8Si6 and a molecular weight of 649.28 g/mol. Its IUPAC name is 2-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]ethanol;2-prop-2-enoxyethanol;trimethyl-[methyl(trimethylsilyloxy)silyl]oxysilane.
| Compound Name | 2-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]ethanol;2-prop-2-enoxyethanol;trimethyl-[methyl(trimethylsilyloxy)silyl]oxysilane |
|---|---|
| PubChem CID | 160950844 |
| Molecular Formula | C24H64O8Si6 |
| Molecular Weight | 649.28 g/mol |
| Exact Mass | 648.32 |
| IUPAC Name | 2-[3-[methyl-bis(trimethylsilyloxy)silyl]propoxy]ethanol;2-prop-2-enoxyethanol;trimethyl-[methyl(trimethylsilyloxy)silyl]oxysilane |
| SMILES | C=CCOCCO.C[SiH](O[Si](C)(C)C)O[Si](C)(C)C.C[Si](C)(C)O[Si](C)(CCCOCCO)O[Si](C)(C)C |
| InChI | InChI=1S/C12H32O4Si3.C7H22O2Si3.C5H10O2/c1-17(2,3)15-19(7,16-18(4,5)6)12-8-10-14-11-9-13;1-10(8-11(2,3)4)9-12(5,6)7;1-2-4-7-5-3-6/h13H,8-12H2,1-7H3;10H,1-7H3;2,6H,1,3-5H2 |
| InChIKey | SVSUJZXWTHSDKW-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.28 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|