C19H50O7Si5 — CID 163469828
2-[3-[methyl-[methyl-[methyl(trimethylsilyloxy)silyl]oxy-pentylsilyl]oxy-trimethylsilyloxysilyl]propoxy]ethane-1,1-diol (PubChem CID 163469828) has the molecular formula C19H50O7Si5 and a molecular weight of 531.03 g/mol. Its IUPAC name is 2-[3-[methyl-[methyl-[methyl(trimethylsilyloxy)silyl]oxy-pentylsilyl]oxy-trimethylsilyloxysilyl]propoxy]ethane-1,1-diol.
| Compound Name | 2-[3-[methyl-[methyl-[methyl(trimethylsilyloxy)silyl]oxy-pentylsilyl]oxy-trimethylsilyloxysilyl]propoxy]ethane-1,1-diol |
|---|---|
| PubChem CID | 163469828 |
| Molecular Formula | C19H50O7Si5 |
| Molecular Weight | 531.03 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | 2-[3-[methyl-[methyl-[methyl(trimethylsilyloxy)silyl]oxy-pentylsilyl]oxy-trimethylsilyloxysilyl]propoxy]ethane-1,1-diol |
| SMILES | CCCCC[Si](C)(O[SiH](C)O[Si](C)(C)C)O[Si](C)(CCCOCC(O)O)O[Si](C)(C)C |
| InChI | InChI=1S/C19H50O7Si5/c1-11-12-13-16-30(9,24-27(2)23-28(3,4)5)26-31(10,25-29(6,7)8)17-14-15-22-18-19(20)21/h19-21,27H,11-18H2,1-10H3 |
| InChIKey | GDBPTHOHULKWST-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.03 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|