C19H44O5Si2 — CID 54147873
2-[4-[[2-[3-(2-hydroxyethoxy)propyl-dimethylsilyl]oxy-2-methylpropyl]-dimethylsilyl]butoxy]ethanol (PubChem CID 54147873) has the molecular formula C19H44O5Si2 and a molecular weight of 408.73 g/mol. Its IUPAC name is 2-[4-[[2-[3-(2-hydroxyethoxy)propyl-dimethylsilyl]oxy-2-methylpropyl]-dimethylsilyl]butoxy]ethanol.
| Compound Name | 2-[4-[[2-[3-(2-hydroxyethoxy)propyl-dimethylsilyl]oxy-2-methylpropyl]-dimethylsilyl]butoxy]ethanol |
|---|---|
| PubChem CID | 54147873 |
| Molecular Formula | C19H44O5Si2 |
| Molecular Weight | 408.73 g/mol |
| Exact Mass | 408.27 |
| IUPAC Name | 2-[4-[[2-[3-(2-hydroxyethoxy)propyl-dimethylsilyl]oxy-2-methylpropyl]-dimethylsilyl]butoxy]ethanol |
| SMILES | CC(C)(C[Si](C)(C)CCCCOCCO)O[Si](C)(C)CCCOCCO |
| InChI | InChI=1S/C19H44O5Si2/c1-19(2,24-26(5,6)17-9-13-23-15-11-21)18-25(3,4)16-8-7-12-22-14-10-20/h20-21H,7-18H2,1-6H3 |
| InChIKey | ZMKYDQRWLRZJGB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.73 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|