C13H32O4Si2 — CID 158678306
3-[2-[3-hydroxypropyl(dimethyl)silyl]oxypropan-2-yloxy-dimethylsilyl]propan-1-ol (PubChem CID 158678306) has the molecular formula C13H32O4Si2 and a molecular weight of 308.57 g/mol. Its IUPAC name is 3-[2-[3-hydroxypropyl(dimethyl)silyl]oxypropan-2-yloxy-dimethylsilyl]propan-1-ol.
| Compound Name | 3-[2-[3-hydroxypropyl(dimethyl)silyl]oxypropan-2-yloxy-dimethylsilyl]propan-1-ol |
|---|---|
| PubChem CID | 158678306 |
| Molecular Formula | C13H32O4Si2 |
| Molecular Weight | 308.57 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | 3-[2-[3-hydroxypropyl(dimethyl)silyl]oxypropan-2-yloxy-dimethylsilyl]propan-1-ol |
| SMILES | CC(C)(O[Si](C)(C)CCCO)O[Si](C)(C)CCCO |
| InChI | InChI=1S/C13H32O4Si2/c1-13(2,16-18(3,4)11-7-9-14)17-19(5,6)12-8-10-15/h14-15H,7-12H2,1-6H3 |
| InChIKey | XYIDRUGJGJMBLO-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.57 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|