C11H28OSi2 — CID 59357456
dimethyl-[(2-methylpropan-2-yl)oxy]-(2-trimethylsilylethyl)silane (PubChem CID 59357456) has the molecular formula C11H28OSi2 and a molecular weight of 232.52 g/mol. Its IUPAC name is dimethyl-[(2-methylpropan-2-yl)oxy]-(2-trimethylsilylethyl)silane.
| Compound Name | dimethyl-[(2-methylpropan-2-yl)oxy]-(2-trimethylsilylethyl)silane |
|---|---|
| PubChem CID | 59357456 |
| Molecular Formula | C11H28OSi2 |
| Molecular Weight | 232.52 g/mol |
| Exact Mass | 232.17 |
| IUPAC Name | dimethyl-[(2-methylpropan-2-yl)oxy]-(2-trimethylsilylethyl)silane |
| SMILES | CC(C)(C)O[Si](C)(C)CC[Si](C)(C)C |
| InChI | InChI=1S/C11H28OSi2/c1-11(2,3)12-14(7,8)10-9-13(4,5)6/h9-10H2,1-8H3 |
| InChIKey | NIVNSDZCNCXLDF-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.52 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|