C6H16O2SiZr — CID 18689460
hydroxy-dimethyl-[(2-methylpropan-2-yl)oxy]silane;zirconium (PubChem CID 18689460) has the molecular formula C6H16O2SiZr and a molecular weight of 239.50 g/mol. Its IUPAC name is hydroxy-dimethyl-[(2-methylpropan-2-yl)oxy]silane;zirconium.
| Compound Name | hydroxy-dimethyl-[(2-methylpropan-2-yl)oxy]silane;zirconium |
|---|---|
| PubChem CID | 18689460 |
| Molecular Formula | C6H16O2SiZr |
| Molecular Weight | 239.50 g/mol |
| Exact Mass | 238.00 |
| IUPAC Name | hydroxy-dimethyl-[(2-methylpropan-2-yl)oxy]silane;zirconium |
| SMILES | CC(C)(C)O[Si](C)(C)O.[Zr] |
| InChI | InChI=1S/C6H16O2Si.Zr/c1-6(2,3)8-9(4,5)7;/h7H,1-5H3; |
| InChIKey | YLWXIKLJTGIDKJ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.50 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|