C7H20O4Si2 — CID 91201697
2-[[hydroxy(dimethyl)silyl]oxy-dimethylsilyl]oxypropan-2-ol (PubChem CID 91201697) has the molecular formula C7H20O4Si2 and a molecular weight of 224.40 g/mol. Its IUPAC name is 2-[[hydroxy(dimethyl)silyl]oxy-dimethylsilyl]oxypropan-2-ol.
| Compound Name | 2-[[hydroxy(dimethyl)silyl]oxy-dimethylsilyl]oxypropan-2-ol |
|---|---|
| PubChem CID | 91201697 |
| Molecular Formula | C7H20O4Si2 |
| Molecular Weight | 224.40 g/mol |
| Exact Mass | 224.09 |
| IUPAC Name | 2-[[hydroxy(dimethyl)silyl]oxy-dimethylsilyl]oxypropan-2-ol |
| SMILES | CC(C)(O)O[Si](C)(C)O[Si](C)(C)O |
| InChI | InChI=1S/C7H20O4Si2/c1-7(2,8)10-13(5,6)11-12(3,4)9/h8-9H,1-6H3 |
| InChIKey | SKKOIIBSUJUFJK-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.40 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|