C15H40O6Si4 — CID 123755721
3-[bis[[3-hydroxypropyl(dimethyl)silyl]oxy]silyloxy-dimethylsilyl]propan-1-ol (PubChem CID 123755721) has the molecular formula C15H40O6Si4 and a molecular weight of 428.82 g/mol. Its IUPAC name is 3-[bis[[3-hydroxypropyl(dimethyl)silyl]oxy]silyloxy-dimethylsilyl]propan-1-ol.
| Compound Name | 3-[bis[[3-hydroxypropyl(dimethyl)silyl]oxy]silyloxy-dimethylsilyl]propan-1-ol |
|---|---|
| PubChem CID | 123755721 |
| Molecular Formula | C15H40O6Si4 |
| Molecular Weight | 428.82 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 3-[bis[[3-hydroxypropyl(dimethyl)silyl]oxy]silyloxy-dimethylsilyl]propan-1-ol |
| SMILES | C[Si](C)(CCCO)O[SiH](O[Si](C)(C)CCCO)O[Si](C)(C)CCCO |
| InChI | InChI=1S/C15H40O6Si4/c1-23(2,13-7-10-16)19-22(20-24(3,4)14-8-11-17)21-25(5,6)15-9-12-18/h16-18,22H,7-15H2,1-6H3 |
| InChIKey | ZZYUJAHQEHQTBK-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.82 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|