C10H14O3 — CID 147998253
6-(2-oxobut-3-enoxy)hex-1-en-3-one (PubChem CID 147998253) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is 6-(2-oxobut-3-enoxy)hex-1-en-3-one.
| Compound Name | 6-(2-oxobut-3-enoxy)hex-1-en-3-one |
|---|---|
| PubChem CID | 147998253 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 6-(2-oxobut-3-enoxy)hex-1-en-3-one |
| SMILES | C=CC(=O)CCCOCC(=O)C=C |
| InChI | InChI=1S/C10H14O3/c1-3-9(11)6-5-7-13-8-10(12)4-2/h3-4H,1-2,5-8H2 |
| InChIKey | IWKQDDKFFLTNHW-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|