C23H36O6 — CID 155329080
4-[4-[5-(2-oxobut-3-enoxy)pentoxycarbonyl]cyclohexyl]cyclohexane-1-carboxylic acid (PubChem CID 155329080) has the molecular formula C23H36O6 and a molecular weight of 408.54 g/mol. Its IUPAC name is 4-[4-[5-(2-oxobut-3-enoxy)pentoxycarbonyl]cyclohexyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[4-[5-(2-oxobut-3-enoxy)pentoxycarbonyl]cyclohexyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 155329080 |
| Molecular Formula | C23H36O6 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | 4-[4-[5-(2-oxobut-3-enoxy)pentoxycarbonyl]cyclohexyl]cyclohexane-1-carboxylic acid |
| SMILES | C=CC(=O)COCCCCCOC(=O)C1CCC(C2CCC(C(=O)O)CC2)CC1 |
| InChI | InChI=1S/C23H36O6/c1-2-21(24)16-28-14-4-3-5-15-29-23(27)20-12-8-18(9-13-20)17-6-10-19(11-7-17)22(25)26/h2,17-20H,1,3-16H2,(H,25,26) |
| InChIKey | LHCBWNQRKFHTRB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|