C21H32O7 — CID 146575500
4-[4-[(Z)-3-(4-hydroxybutoxy)-3-oxoprop-1-enoxy]carbonylcyclohexyl]cyclohexane-1-carboxylic acid (PubChem CID 146575500) has the molecular formula C21H32O7 and a molecular weight of 396.48 g/mol. Its IUPAC name is 4-[4-[(Z)-3-(4-hydroxybutoxy)-3-oxoprop-1-enoxy]carbonylcyclohexyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[4-[(Z)-3-(4-hydroxybutoxy)-3-oxoprop-1-enoxy]carbonylcyclohexyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 146575500 |
| Molecular Formula | C21H32O7 |
| Molecular Weight | 396.48 g/mol |
| Exact Mass | 396.21 |
| IUPAC Name | 4-[4-[(Z)-3-(4-hydroxybutoxy)-3-oxoprop-1-enoxy]carbonylcyclohexyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(/C=C\OC(=O)C1CCC(C2CCC(C(=O)O)CC2)CC1)OCCCCO |
| InChI | InChI=1S/C21H32O7/c22-12-1-2-13-27-19(23)11-14-28-21(26)18-9-5-16(6-10-18)15-3-7-17(8-4-15)20(24)25/h11,14-18,22H,1-10,12-13H2,(H,24,25)/b14-11- |
| InChIKey | IIMXURYAEATTFG-KAMYIIQDSA-N |
| XLogP | 3.06 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|