C22H38O8 — CID 153490947
[2-hydroxy-3-(4-prop-2-enoyloxybutoxy)propyl] 6-(2,2-dimethylbutanoyloxy)hexanoate (PubChem CID 153490947) has the molecular formula C22H38O8 and a molecular weight of 430.54 g/mol. Its IUPAC name is [2-hydroxy-3-(4-prop-2-enoyloxybutoxy)propyl] 6-(2,2-dimethylbutanoyloxy)hexanoate.
| Compound Name | [2-hydroxy-3-(4-prop-2-enoyloxybutoxy)propyl] 6-(2,2-dimethylbutanoyloxy)hexanoate |
|---|---|
| PubChem CID | 153490947 |
| Molecular Formula | C22H38O8 |
| Molecular Weight | 430.54 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | [2-hydroxy-3-(4-prop-2-enoyloxybutoxy)propyl] 6-(2,2-dimethylbutanoyloxy)hexanoate |
| SMILES | C=CC(=O)OCCCCOCC(O)COC(=O)CCCCCOC(=O)C(C)(C)CC |
| InChI | InChI=1S/C22H38O8/c1-5-19(24)28-14-11-10-13-27-16-18(23)17-30-20(25)12-8-7-9-15-29-21(26)22(3,4)6-2/h5,18,23H,1,6-17H2,2-4H3 |
| InChIKey | JUAWAWTVZFGLPE-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.54 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|