C12H20O4 — CID 23396729
3-prop-2-enoyloxypropyl 2,2-dimethylbutanoate (PubChem CID 23396729) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is 3-prop-2-enoyloxypropyl 2,2-dimethylbutanoate.
| Compound Name | 3-prop-2-enoyloxypropyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 23396729 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 3-prop-2-enoyloxypropyl 2,2-dimethylbutanoate |
| SMILES | C=CC(=O)OCCCOC(=O)C(C)(C)CC |
| InChI | InChI=1S/C12H20O4/c1-5-10(13)15-8-7-9-16-11(14)12(3,4)6-2/h5H,1,6-9H2,2-4H3 |
| InChIKey | SMFHKMBDPBAUFL-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|