C41H70O15 — CID 159642868
[2-[4-(2,2-dimethylbutanoyloxy)butoxy]-1-hydroxyethyl] 6-(6-prop-2-enoyloxyhexanoyloxy)hexanoate;2-(1-prop-2-enoyloxypropan-2-yloxy)ethyl 2,2-dimethylbutanoate (PubChem CID 159642868) has the molecular formula C41H70O15 and a molecular weight of 803.00 g/mol. Its IUPAC name is [2-[4-(2,2-dimethylbutanoyloxy)butoxy]-1-hydroxyethyl] 6-(6-prop-2-enoyloxyhexanoyloxy)hexanoate;2-(1-prop-2-enoyloxypropan-2-yloxy)ethyl 2,2-dimethylbutanoate.
| Compound Name | [2-[4-(2,2-dimethylbutanoyloxy)butoxy]-1-hydroxyethyl] 6-(6-prop-2-enoyloxyhexanoyloxy)hexanoate;2-(1-prop-2-enoyloxypropan-2-yloxy)ethyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 159642868 |
| Molecular Formula | C41H70O15 |
| Molecular Weight | 803.00 g/mol |
| Exact Mass | 802.47 |
| IUPAC Name | [2-[4-(2,2-dimethylbutanoyloxy)butoxy]-1-hydroxyethyl] 6-(6-prop-2-enoyloxyhexanoyloxy)hexanoate;2-(1-prop-2-enoyloxypropan-2-yloxy)ethyl 2,2-dimethylbutanoate |
| SMILES | C=CC(=O)OCC(C)OCCOC(=O)C(C)(C)CC.C=CC(=O)OCCCCCC(=O)OCCCCCC(=O)OC(O)COCCCCOC(=O)C(C)(C)CC |
| InChI | InChI=1S/C27H46O10.C14H24O5/c1-5-22(28)34-18-11-7-9-15-23(29)35-19-12-8-10-16-24(30)37-25(31)21-33-17-13-14-20-36-26(32)27(3,4)6-2;1-6-12(15)19-10-11(3)17-8-9-18-13(16)14(4,5)7-2/h5,25,31H,1,6-21H2,2-4H3;6,11H,1,7-10H2,2-5H3 |
| InChIKey | MQOQYPHRAJQHMG-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 196.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 803.00 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|