C12H21NO2 — CID 141191229
2-(dimethylamino)propyl (E)-3-methyl-2-methylidenepent-3-enoate (PubChem CID 141191229) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is 2-(dimethylamino)propyl (E)-3-methyl-2-methylidenepent-3-enoate.
| Compound Name | 2-(dimethylamino)propyl (E)-3-methyl-2-methylidenepent-3-enoate |
|---|---|
| PubChem CID | 141191229 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 2-(dimethylamino)propyl (E)-3-methyl-2-methylidenepent-3-enoate |
| SMILES | C=C(C(=O)OCC(C)N(C)C)/C(C)=C/C |
| InChI | InChI=1S/C12H21NO2/c1-7-9(2)11(4)12(14)15-8-10(3)13(5)6/h7,10H,4,8H2,1-3,5-6H3/b9-7+ |
| InChIKey | AEGSXYVZHAOCFD-VQHVLOKHSA-N |
| XLogP | 2.00 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|