About 2-(dimethylamino)propyl 2-(1-ethenylpyrrol-2-yl)prop-2-enoate
2-(dimethylamino)propyl 2-(1-ethenylpyrrol-2-yl)prop-2-enoate (PubChem CID 141039462) has the molecular formula C14H20N2O2
and a molecular weight of 248.33 g/mol. Its IUPAC name is 2-(dimethylamino)propyl 2-(1-ethenylpyrrol-2-yl)prop-2-enoate.
Molecular Properties
| Compound Name | 2-(dimethylamino)propyl 2-(1-ethenylpyrrol-2-yl)prop-2-enoate |
| PubChem CID | 141039462 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | 2-(dimethylamino)propyl 2-(1-ethenylpyrrol-2-yl)prop-2-enoate |
| SMILES | C=Cn1cccc1C(=C)C(=O)OCC(C)N(C)C |
| InChI | InChI=1S/C14H20N2O2/c1-6-16-9-7-8-13(16)12(3)14(17)18-10-11(2)15(4)5/h6-9,11H,1,3,10H2,2,4-5H3 |
| InChIKey | ABWBFARVBYIVKD-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 34.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)propyl 2-(1-ethenylpyrrol-2-yl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)propyl 2-(1-ethenylpyrrol-2-yl)prop-2-enoate?
The IUPAC name of 2-(dimethylamino)propyl 2-(1-ethenylpyrrol-2-yl)prop-2-enoate (CID 141039462) is 2-(dimethylamino)propyl 2-(1-ethenylpyrrol-2-yl)prop-2-enoate.
What is the SMILES notation for 2-(dimethylamino)propyl 2-(1-ethenylpyrrol-2-yl)prop-2-enoate?
The canonical SMILES for 2-(dimethylamino)propyl 2-(1-ethenylpyrrol-2-yl)prop-2-enoate is C=Cn1cccc1C(=C)C(=O)OCC(C)N(C)C.
What is the InChIKey of 2-(dimethylamino)propyl 2-(1-ethenylpyrrol-2-yl)prop-2-enoate?
The InChIKey is ABWBFARVBYIVKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20N2O2/c1-6-16-9-7-8-13(16)12(3)14(17)18-10-11(2)15(4)5/h6-9,11H,1,3,10H2,2,4-5H3.
What are the key properties of 2-(dimethylamino)propyl 2-(1-ethenylpyrrol-2-yl)prop-2-enoate?
2-(dimethylamino)propyl 2-(1-ethenylpyrrol-2-yl)prop-2-enoate has a molecular weight of 248.33 g/mol, XLogP of 2.10, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)propyl 2-(1-ethenylpyrrol-2-yl)prop-2-enoate is sourced from PubChem (CID 141039462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).