About 2-(dimethylamino)propyl 3-oxo-2-pyrrolidin-1-ylprop-2-enoate
2-(dimethylamino)propyl 3-oxo-2-pyrrolidin-1-ylprop-2-enoate (PubChem CID 141122455) has the molecular formula C12H20N2O3
and a molecular weight of 240.30 g/mol. Its IUPAC name is 2-(dimethylamino)propyl 3-oxo-2-pyrrolidin-1-ylprop-2-enoate.
Molecular Properties
| Compound Name | 2-(dimethylamino)propyl 3-oxo-2-pyrrolidin-1-ylprop-2-enoate |
| PubChem CID | 141122455 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 2-(dimethylamino)propyl 3-oxo-2-pyrrolidin-1-ylprop-2-enoate |
| SMILES | CC(COC(=O)C(=C=O)N1CCCC1)N(C)C |
| InChI | InChI=1S/C12H20N2O3/c1-10(13(2)3)9-17-12(16)11(8-15)14-6-4-5-7-14/h10H,4-7,9H2,1-3H3 |
| InChIKey | BJJUNTKPYYKVOZ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)propyl 3-oxo-2-pyrrolidin-1-ylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)propyl 3-oxo-2-pyrrolidin-1-ylprop-2-enoate?
The IUPAC name of 2-(dimethylamino)propyl 3-oxo-2-pyrrolidin-1-ylprop-2-enoate (CID 141122455) is 2-(dimethylamino)propyl 3-oxo-2-pyrrolidin-1-ylprop-2-enoate.
What is the SMILES notation for 2-(dimethylamino)propyl 3-oxo-2-pyrrolidin-1-ylprop-2-enoate?
The canonical SMILES for 2-(dimethylamino)propyl 3-oxo-2-pyrrolidin-1-ylprop-2-enoate is CC(COC(=O)C(=C=O)N1CCCC1)N(C)C.
What is the InChIKey of 2-(dimethylamino)propyl 3-oxo-2-pyrrolidin-1-ylprop-2-enoate?
The InChIKey is BJJUNTKPYYKVOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2O3/c1-10(13(2)3)9-17-12(16)11(8-15)14-6-4-5-7-14/h10H,4-7,9H2,1-3H3.
What are the key properties of 2-(dimethylamino)propyl 3-oxo-2-pyrrolidin-1-ylprop-2-enoate?
2-(dimethylamino)propyl 3-oxo-2-pyrrolidin-1-ylprop-2-enoate has a molecular weight of 240.30 g/mol, XLogP of 0.29, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)propyl 3-oxo-2-pyrrolidin-1-ylprop-2-enoate is sourced from PubChem (CID 141122455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).