C15H28NO5+ — CID 162495521
(2-hydroxy-3-prop-2-enoyloxypropyl)-dimethyl-[2-(2-methylbutanoyloxy)ethyl]azanium (PubChem CID 162495521) has the molecular formula C15H28NO5+ and a molecular weight of 302.39 g/mol. Its IUPAC name is (2-hydroxy-3-prop-2-enoyloxypropyl)-dimethyl-[2-(2-methylbutanoyloxy)ethyl]azanium.
| Compound Name | (2-hydroxy-3-prop-2-enoyloxypropyl)-dimethyl-[2-(2-methylbutanoyloxy)ethyl]azanium |
|---|---|
| PubChem CID | 162495521 |
| Molecular Formula | C15H28NO5+ |
| Molecular Weight | 302.39 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | (2-hydroxy-3-prop-2-enoyloxypropyl)-dimethyl-[2-(2-methylbutanoyloxy)ethyl]azanium |
| SMILES | C=CC(=O)OCC(O)C[N+](C)(C)CCOC(=O)C(C)CC |
| InChI | InChI=1S/C15H28NO5/c1-6-12(3)15(19)20-9-8-16(4,5)10-13(17)11-21-14(18)7-2/h7,12-13,17H,2,6,8-11H2,1,3-5H3/q+1 |
| InChIKey | CUYLOFAPAOZHNM-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.39 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|