C11H21NO6S — CID 156509263
3-[dimethyl(3-prop-2-enoyloxypropyl)azaniumyl]-2-hydroxypropane-1-sulfonate (PubChem CID 156509263) has the molecular formula C11H21NO6S and a molecular weight of 295.36 g/mol. Its IUPAC name is 3-[dimethyl(3-prop-2-enoyloxypropyl)azaniumyl]-2-hydroxypropane-1-sulfonate.
| Compound Name | 3-[dimethyl(3-prop-2-enoyloxypropyl)azaniumyl]-2-hydroxypropane-1-sulfonate |
|---|---|
| PubChem CID | 156509263 |
| Molecular Formula | C11H21NO6S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 3-[dimethyl(3-prop-2-enoyloxypropyl)azaniumyl]-2-hydroxypropane-1-sulfonate |
| SMILES | C=CC(=O)OCCC[N+](C)(C)CC(O)CS(=O)(=O)[O-] |
| InChI | InChI=1S/C11H21NO6S/c1-4-11(14)18-7-5-6-12(2,3)8-10(13)9-19(15,16)17/h4,10,13H,1,5-9H2,2-3H3 |
| InChIKey | WIQQVMUQGGCFFM-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|