C18H19F17Si — CID 86663264
ethynyl-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-di(propan-2-yl)silane (PubChem CID 86663264) has the molecular formula C18H19F17Si and a molecular weight of 586.40 g/mol. Its IUPAC name is ethynyl-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-di(propan-2-yl)silane.
| Compound Name | ethynyl-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-di(propan-2-yl)silane |
|---|---|
| PubChem CID | 86663264 |
| Molecular Formula | C18H19F17Si |
| Molecular Weight | 586.40 g/mol |
| Exact Mass | 586.10 |
| IUPAC Name | ethynyl-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl)-di(propan-2-yl)silane |
| SMILES | C#C[Si](CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(C(C)C)C(C)C |
| InChI | InChI=1S/C18H19F17Si/c1-6-36(9(2)3,10(4)5)8-7-11(19,20)12(21,22)13(23,24)14(25,26)15(27,28)16(29,30)17(31,32)18(33,34)35/h1,9-10H,7-8H2,2-5H3 |
| InChIKey | SBXRLPCLQPFVNR-UHFFFAOYSA-N |
| XLogP | 8.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.40 |
| LogP ≤ 5 | 8.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|