C13H13F13Si — CID 88660382
dimethyl-prop-2-ynyl-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane (PubChem CID 88660382) has the molecular formula C13H13F13Si and a molecular weight of 444.31 g/mol. Its IUPAC name is dimethyl-prop-2-ynyl-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane.
| Compound Name | dimethyl-prop-2-ynyl-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane |
|---|---|
| PubChem CID | 88660382 |
| Molecular Formula | C13H13F13Si |
| Molecular Weight | 444.31 g/mol |
| Exact Mass | 444.06 |
| IUPAC Name | dimethyl-prop-2-ynyl-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane |
| SMILES | C#CC[Si](C)(C)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C13H13F13Si/c1-4-6-27(2,3)7-5-8(14,15)9(16,17)10(18,19)11(20,21)12(22,23)13(24,25)26/h1H,5-7H2,2-3H3 |
| InChIKey | WMKIGYOWFRTIKP-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.31 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|