About ethane;(5R)-3,3,5-trimethyloctane
ethane;(5R)-3,3,5-trimethyloctane (PubChem CID 143538899) has the molecular formula C13H30
and a molecular weight of 186.38 g/mol. Its IUPAC name is ethane;(5R)-3,3,5-trimethyloctane.
Molecular Properties
| Compound Name | ethane;(5R)-3,3,5-trimethyloctane |
| PubChem CID | 143538899 |
| Molecular Formula | C13H30 |
| Molecular Weight | 186.38 g/mol |
| Exact Mass | 186.23 |
| IUPAC Name | ethane;(5R)-3,3,5-trimethyloctane |
| SMILES | CC.CCC[C@@H](C)CC(C)(C)CC |
| InChI | InChI=1S/C11H24.C2H6/c1-6-8-10(3)9-11(4,5)7-2;1-2/h10H,6-9H2,1-5H3;1-2H3/t10-;/m1./s1 |
| InChIKey | WGCBDVGIYPXITN-HNCPQSOCSA-N |
| XLogP | 5.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 186.38 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;(5R)-3,3,5-trimethyloctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(5R)-3,3,5-trimethyloctane?
The IUPAC name of ethane;(5R)-3,3,5-trimethyloctane (CID 143538899) is ethane;(5R)-3,3,5-trimethyloctane.
What is the SMILES notation for ethane;(5R)-3,3,5-trimethyloctane?
The canonical SMILES for ethane;(5R)-3,3,5-trimethyloctane is CC.CCC[C@@H](C)CC(C)(C)CC.
What is the InChIKey of ethane;(5R)-3,3,5-trimethyloctane?
The InChIKey is WGCBDVGIYPXITN-HNCPQSOCSA-N. The full InChI is InChI=1S/C11H24.C2H6/c1-6-8-10(3)9-11(4,5)7-2;1-2/h10H,6-9H2,1-5H3;1-2H3/t10-;/m1./s1.
What are the key properties of ethane;(5R)-3,3,5-trimethyloctane?
ethane;(5R)-3,3,5-trimethyloctane has a molecular weight of 186.38 g/mol, XLogP of 5.28, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(5R)-3,3,5-trimethyloctane is sourced from PubChem (CID 143538899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).