C14H28O2 — CID 143847726
2,2,4,4,6-pentamethylnonanoic acid (PubChem CID 143847726) has the molecular formula C14H28O2 and a molecular weight of 228.38 g/mol. Its IUPAC name is 2,2,4,4,6-pentamethylnonanoic acid.
| Compound Name | 2,2,4,4,6-pentamethylnonanoic acid |
|---|---|
| PubChem CID | 143847726 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | 2,2,4,4,6-pentamethylnonanoic acid |
| SMILES | CCCC(C)CC(C)(C)CC(C)(C)C(=O)O |
| InChI | InChI=1S/C14H28O2/c1-7-8-11(2)9-13(3,4)10-14(5,6)12(15)16/h11H,7-10H2,1-6H3,(H,15,16) |
| InChIKey | RLJXEWGGIVEHEW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |