C10H17N4O5- — CID 25245674
(2S)-2-(3-carboxylatopropanoylamino)-5-(diaminomethylideneazaniumyl)pentanoate (PubChem CID 25245674) has the molecular formula C10H17N4O5- and a molecular weight of 273.27 g/mol. Its IUPAC name is (2S)-2-(3-carboxylatopropanoylamino)-5-(diaminomethylideneazaniumyl)pentanoate.
| Compound Name | (2S)-2-(3-carboxylatopropanoylamino)-5-(diaminomethylideneazaniumyl)pentanoate |
|---|---|
| PubChem CID | 25245674 |
| Molecular Formula | C10H17N4O5- |
| Molecular Weight | 273.27 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | (2S)-2-(3-carboxylatopropanoylamino)-5-(diaminomethylideneazaniumyl)pentanoate |
| SMILES | NC(N)=[NH+]CCC[C@H](NC(=O)CCC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C10H18N4O5/c11-10(12)13-5-1-2-6(9(18)19)14-7(15)3-4-8(16)17/h6H,1-5H2,(H,14,15)(H,16,17)(H,18,19)(H4,11,12,13)/p-1/t6-/m0/s1 |
| InChIKey | UMOXFSXIFQOWTD-LURJTMIESA-M |
| XLogP | -6.11 |
| TPSA | 175.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.27 |
| LogP ≤ 5 | -6.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|