C13H18N4O3 — CID 7005101
(2R)-2-benzamido-5-(diaminomethylideneazaniumyl)pentanoate (PubChem CID 7005101) has the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is (2R)-2-benzamido-5-(diaminomethylideneazaniumyl)pentanoate.
| Compound Name | (2R)-2-benzamido-5-(diaminomethylideneazaniumyl)pentanoate |
|---|---|
| PubChem CID | 7005101 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | (2R)-2-benzamido-5-(diaminomethylideneazaniumyl)pentanoate |
| SMILES | NC(N)=[NH+]CCC[C@@H](NC(=O)c1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C13H18N4O3/c14-13(15)16-8-4-7-10(12(19)20)17-11(18)9-5-2-1-3-6-9/h1-3,5-6,10H,4,7-8H2,(H,17,18)(H,19,20)(H4,14,15,16)/t10-/m1/s1 |
| InChIKey | RSYYQCDERUOEFI-SNVBAGLBSA-N |
| XLogP | -3.33 |
| TPSA | 135.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | -3.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|