C24H26N4O10Sn — CID 70358108
bis((2S)-2-[(4-aminobenzoyl)amino]-5-hydroxy-5-oxopentanoate);tin(2+) (PubChem CID 70358108) has the molecular formula C24H26N4O10Sn and a molecular weight of 649.20 g/mol. Its IUPAC name is bis((2S)-2-[(4-aminobenzoyl)amino]-5-hydroxy-5-oxopentanoate);tin(2+).
| Compound Name | bis((2S)-2-[(4-aminobenzoyl)amino]-5-hydroxy-5-oxopentanoate);tin(2+) |
|---|---|
| PubChem CID | 70358108 |
| Molecular Formula | C24H26N4O10Sn |
| Molecular Weight | 649.20 g/mol |
| Exact Mass | 650.07 |
| IUPAC Name | bis((2S)-2-[(4-aminobenzoyl)amino]-5-hydroxy-5-oxopentanoate);tin(2+) |
| SMILES | Nc1ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)[O-])cc1.Nc1ccc(C(=O)N[C@@H](CCC(=O)O)C(=O)[O-])cc1.[Sn+2] |
| InChI | InChI=1S/2C12H14N2O5.Sn/c2*13-8-3-1-7(2-4-8)11(17)14-9(12(18)19)5-6-10(15)16;/h2*1-4,9H,5-6,13H2,(H,14,17)(H,15,16)(H,18,19);/q;;+2/p-2/t2*9-;/m00./s1 |
| InChIKey | HNLKPZXYHNHRFF-NAWJVIAPSA-L |
| XLogP | -2.42 |
| TPSA | 265.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.20 |
| LogP ≤ 5 | -2.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|