C12H14N2O5 — CID 10825892
(4S)-4-[(4-aminobenzoyl)amino]-2,2,3,3-tetradeuteriopentanedioic acid (PubChem CID 10825892) has the molecular formula C12H14N2O5 and a molecular weight of 270.28 g/mol. Its IUPAC name is (4S)-4-[(4-aminobenzoyl)amino]-2,2,3,3-tetradeuteriopentanedioic acid.
| Compound Name | (4S)-4-[(4-aminobenzoyl)amino]-2,2,3,3-tetradeuteriopentanedioic acid |
|---|---|
| PubChem CID | 10825892 |
| Molecular Formula | C12H14N2O5 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | (4S)-4-[(4-aminobenzoyl)amino]-2,2,3,3-tetradeuteriopentanedioic acid |
| SMILES | [2H]C([2H])(C(=O)O)C([2H])([2H])[C@H](NC(=O)c1ccc(N)cc1)C(=O)O |
| InChI | InChI=1S/C12H14N2O5/c13-8-3-1-7(2-4-8)11(17)14-9(12(18)19)5-6-10(15)16/h1-4,9H,5-6,13H2,(H,14,17)(H,15,16)(H,18,19)/t9-/m0/s1/i5D2,6D2 |
| InChIKey | GADGMZDHLQLZRI-JZIFLIAGSA-N |
| XLogP | 0.32 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|