C12H12FN2O4- — CID 2369526
(2R)-5-amino-2-[(4-fluorobenzoyl)amino]-5-oxopentanoate (PubChem CID 2369526) has the molecular formula C12H12FN2O4- and a molecular weight of 267.24 g/mol. Its IUPAC name is (2R)-5-amino-2-[(4-fluorobenzoyl)amino]-5-oxopentanoate.
| Compound Name | (2R)-5-amino-2-[(4-fluorobenzoyl)amino]-5-oxopentanoate |
|---|---|
| PubChem CID | 2369526 |
| Molecular Formula | C12H12FN2O4- |
| Molecular Weight | 267.24 g/mol |
| Exact Mass | 267.08 |
| IUPAC Name | (2R)-5-amino-2-[(4-fluorobenzoyl)amino]-5-oxopentanoate |
| SMILES | NC(=O)CC[C@@H](NC(=O)c1ccc(F)cc1)C(=O)[O-] |
| InChI | InChI=1S/C12H13FN2O4/c13-8-3-1-7(2-4-8)11(17)15-9(12(18)19)5-6-10(14)16/h1-4,9H,5-6H2,(H2,14,16)(H,15,17)(H,18,19)/p-1/t9-/m1/s1 |
| InChIKey | KCUJDSOLGULFAG-SECBINFHSA-M |
| XLogP | -1.06 |
| TPSA | 112.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.24 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |