C12H13N2NaO5 — CID 86278232
sodium;(2S)-2-[(4-aminobenzoyl)amino]pentanedioate;hydron (PubChem CID 86278232) has the molecular formula C12H13N2NaO5 and a molecular weight of 288.23 g/mol. Its IUPAC name is sodium;(2S)-2-[(4-aminobenzoyl)amino]pentanedioate;hydron.
| Compound Name | sodium;(2S)-2-[(4-aminobenzoyl)amino]pentanedioate;hydron |
|---|---|
| PubChem CID | 86278232 |
| Molecular Formula | C12H13N2NaO5 |
| Molecular Weight | 288.23 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | sodium;(2S)-2-[(4-aminobenzoyl)amino]pentanedioate;hydron |
| SMILES | Nc1ccc(C(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-])cc1.[H+].[Na+] |
| InChI | InChI=1S/C12H14N2O5.Na/c13-8-3-1-7(2-4-8)11(17)14-9(12(18)19)5-6-10(15)16;/h1-4,9H,5-6,13H2,(H,14,17)(H,15,16)(H,18,19);/q;+1/p-1/t9-;/m0./s1 |
| InChIKey | QTFDQUUWYNVHIJ-FVGYRXGTSA-M |
| XLogP | -5.24 |
| TPSA | 135.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.23 |
| LogP ≤ 5 | -5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|