C29H31N6O3+ — CID 140656423
[(4S)-4-[(2-benzhydryl-4-phenyl-1H-imidazole-5-carbonyl)amino]-4-carboxybutyl]-(diaminomethylidene)azanium (PubChem CID 140656423) has the molecular formula C29H31N6O3+ and a molecular weight of 511.61 g/mol. Its IUPAC name is [(4S)-4-[(2-benzhydryl-4-phenyl-1H-imidazole-5-carbonyl)amino]-4-carboxybutyl]-(diaminomethylidene)azanium.
| Compound Name | [(4S)-4-[(2-benzhydryl-4-phenyl-1H-imidazole-5-carbonyl)amino]-4-carboxybutyl]-(diaminomethylidene)azanium |
|---|---|
| PubChem CID | 140656423 |
| Molecular Formula | C29H31N6O3+ |
| Molecular Weight | 511.61 g/mol |
| Exact Mass | 511.25 |
| IUPAC Name | [(4S)-4-[(2-benzhydryl-4-phenyl-1H-imidazole-5-carbonyl)amino]-4-carboxybutyl]-(diaminomethylidene)azanium |
| SMILES | NC(N)=[NH+]CCC[C@H](NC(=O)c1[nH]c(C(c2ccccc2)c2ccccc2)nc1-c1ccccc1)C(=O)O |
| InChI | InChI=1S/C29H30N6O3/c30-29(31)32-18-10-17-22(28(37)38)33-27(36)25-24(21-15-8-3-9-16-21)34-26(35-25)23(19-11-4-1-5-12-19)20-13-6-2-7-14-20/h1-9,11-16,22-23H,10,17-18H2,(H,33,36)(H,34,35)(H,37,38)(H4,30,31,32)/p+1/t22-/m0/s1 |
| InChIKey | UGZOTXNTWGANNE-QFIPXVFZSA-O |
| XLogP | 1.57 |
| TPSA | 161.09 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.61 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|