C31H29F3N4O5S — CID 86622191
(2S)-5-[[amino(pyridin-2-yl)methylidene]amino]-2-[(5-benzhydrylthiophene-2-carbonyl)amino]pentanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 86622191) has the molecular formula C31H29F3N4O5S and a molecular weight of 626.66 g/mol. Its IUPAC name is (2S)-5-[[amino(pyridin-2-yl)methylidene]amino]-2-[(5-benzhydrylthiophene-2-carbonyl)amino]pentanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-5-[[amino(pyridin-2-yl)methylidene]amino]-2-[(5-benzhydrylthiophene-2-carbonyl)amino]pentanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 86622191 |
| Molecular Formula | C31H29F3N4O5S |
| Molecular Weight | 626.66 g/mol |
| Exact Mass | 626.18 |
| IUPAC Name | (2S)-5-[[amino(pyridin-2-yl)methylidene]amino]-2-[(5-benzhydrylthiophene-2-carbonyl)amino]pentanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | N/C(=N\CCC[C@H](NC(=O)c1ccc(C(c2ccccc2)c2ccccc2)s1)C(=O)O)c1ccccn1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C29H28N4O3S.C2HF3O2/c30-27(22-14-7-8-18-31-22)32-19-9-15-23(29(35)36)33-28(34)25-17-16-24(37-25)26(20-10-3-1-4-11-20)21-12-5-2-6-13-21;3-2(4,5)1(6)7/h1-8,10-14,16-18,23,26H,9,15,19H2,(H2,30,32)(H,33,34)(H,35,36);(H,6,7)/t23-;/m0./s1 |
| InChIKey | VPRYBRPJRIEXKH-BQAIUKQQSA-N |
| XLogP | 5.33 |
| TPSA | 154.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.66 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|