C31H31N3O4S — CID 174588393
5-[[2-(1H-azepin-2-yl)acetyl]amino]-2-[(5-benzhydrylthiophene-2-carbonyl)amino]pentanoic acid (PubChem CID 174588393) has the molecular formula C31H31N3O4S and a molecular weight of 541.67 g/mol. Its IUPAC name is 5-[[2-(1H-azepin-2-yl)acetyl]amino]-2-[(5-benzhydrylthiophene-2-carbonyl)amino]pentanoic acid.
| Compound Name | 5-[[2-(1H-azepin-2-yl)acetyl]amino]-2-[(5-benzhydrylthiophene-2-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 174588393 |
| Molecular Formula | C31H31N3O4S |
| Molecular Weight | 541.67 g/mol |
| Exact Mass | 541.20 |
| IUPAC Name | 5-[[2-(1H-azepin-2-yl)acetyl]amino]-2-[(5-benzhydrylthiophene-2-carbonyl)amino]pentanoic acid |
| SMILES | O=C(CC1=CC=CC=CN1)NCCCC(NC(=O)c1ccc(C(c2ccccc2)c2ccccc2)s1)C(=O)O |
| InChI | InChI=1S/C31H31N3O4S/c35-28(21-24-15-8-3-9-19-32-24)33-20-10-16-25(31(37)38)34-30(36)27-18-17-26(39-27)29(22-11-4-1-5-12-22)23-13-6-2-7-14-23/h1-9,11-15,17-19,25,29,32H,10,16,20-21H2,(H,33,35)(H,34,36)(H,37,38) |
| InChIKey | ZRSJINHCDSZAJP-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.67 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|