C28H25N3O3S — CID 59775023
(2S)-2-[4-(1-aminoethylideneamino)phenyl]-2-[(5-benzhydrylthiophene-2-carbonyl)amino]acetic acid (PubChem CID 59775023) has the molecular formula C28H25N3O3S and a molecular weight of 483.59 g/mol. Its IUPAC name is (2S)-2-[4-(1-aminoethylideneamino)phenyl]-2-[(5-benzhydrylthiophene-2-carbonyl)amino]acetic acid.
| Compound Name | (2S)-2-[4-(1-aminoethylideneamino)phenyl]-2-[(5-benzhydrylthiophene-2-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 59775023 |
| Molecular Formula | C28H25N3O3S |
| Molecular Weight | 483.59 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | (2S)-2-[4-(1-aminoethylideneamino)phenyl]-2-[(5-benzhydrylthiophene-2-carbonyl)amino]acetic acid |
| SMILES | C/C(N)=N\c1ccc([C@H](NC(=O)c2ccc(C(c3ccccc3)c3ccccc3)s2)C(=O)O)cc1 |
| InChI | InChI=1S/C28H25N3O3S/c1-18(29)30-22-14-12-21(13-15-22)26(28(33)34)31-27(32)24-17-16-23(35-24)25(19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-17,25-26H,1H3,(H2,29,30)(H,31,32)(H,33,34)/t26-/m0/s1 |
| InChIKey | RGSYWDTWQAYUQW-SANMLTNESA-N |
| XLogP | 5.49 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.59 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|