C28H23F3N2O5S — CID 86622240
2-(3-aminophenyl)-2-[(5-benzhydrylthiophene-2-carbonyl)amino]acetic acid;2,2,2-trifluoroacetic acid (PubChem CID 86622240) has the molecular formula C28H23F3N2O5S and a molecular weight of 556.56 g/mol. Its IUPAC name is 2-(3-aminophenyl)-2-[(5-benzhydrylthiophene-2-carbonyl)amino]acetic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-(3-aminophenyl)-2-[(5-benzhydrylthiophene-2-carbonyl)amino]acetic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 86622240 |
| Molecular Formula | C28H23F3N2O5S |
| Molecular Weight | 556.56 g/mol |
| Exact Mass | 556.13 |
| IUPAC Name | 2-(3-aminophenyl)-2-[(5-benzhydrylthiophene-2-carbonyl)amino]acetic acid;2,2,2-trifluoroacetic acid |
| SMILES | Nc1cccc(C(NC(=O)c2ccc(C(c3ccccc3)c3ccccc3)s2)C(=O)O)c1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C26H22N2O3S.C2HF3O2/c27-20-13-7-12-19(16-20)24(26(30)31)28-25(29)22-15-14-21(32-22)23(17-8-3-1-4-9-17)18-10-5-2-6-11-18;3-2(4,5)1(6)7/h1-16,23-24H,27H2,(H,28,29)(H,30,31);(H,6,7) |
| InChIKey | JXGGFYGPWVPFHP-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.56 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|