C20H14F3NO4S — CID 11327633
(2R)-2-phenyl-2-[[4-[4-(trifluoromethoxy)phenyl]thiophene-2-carbonyl]amino]acetic acid (PubChem CID 11327633) has the molecular formula C20H14F3NO4S and a molecular weight of 421.40 g/mol. Its IUPAC name is (2R)-2-phenyl-2-[[4-[4-(trifluoromethoxy)phenyl]thiophene-2-carbonyl]amino]acetic acid.
| Compound Name | (2R)-2-phenyl-2-[[4-[4-(trifluoromethoxy)phenyl]thiophene-2-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 11327633 |
| Molecular Formula | C20H14F3NO4S |
| Molecular Weight | 421.40 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | (2R)-2-phenyl-2-[[4-[4-(trifluoromethoxy)phenyl]thiophene-2-carbonyl]amino]acetic acid |
| SMILES | O=C(N[C@@H](C(=O)O)c1ccccc1)c1cc(-c2ccc(OC(F)(F)F)cc2)cs1 |
| InChI | InChI=1S/C20H14F3NO4S/c21-20(22,23)28-15-8-6-12(7-9-15)14-10-16(29-11-14)18(25)24-17(19(26)27)13-4-2-1-3-5-13/h1-11,17H,(H,24,25)(H,26,27)/t17-/m1/s1 |
| InChIKey | QSXWMSOERGLVDJ-QGZVFWFLSA-N |
| XLogP | 4.87 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.40 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |