C23H20F3NO4S — CID 59983755
5-phenyl-5-[[4-[4-(trifluoromethoxy)phenyl]thiophene-2-carbonyl]amino]pentanoic acid (PubChem CID 59983755) has the molecular formula C23H20F3NO4S and a molecular weight of 463.48 g/mol. Its IUPAC name is 5-phenyl-5-[[4-[4-(trifluoromethoxy)phenyl]thiophene-2-carbonyl]amino]pentanoic acid.
| Compound Name | 5-phenyl-5-[[4-[4-(trifluoromethoxy)phenyl]thiophene-2-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 59983755 |
| Molecular Formula | C23H20F3NO4S |
| Molecular Weight | 463.48 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | 5-phenyl-5-[[4-[4-(trifluoromethoxy)phenyl]thiophene-2-carbonyl]amino]pentanoic acid |
| SMILES | O=C(O)CCCC(NC(=O)c1cc(-c2ccc(OC(F)(F)F)cc2)cs1)c1ccccc1 |
| InChI | InChI=1S/C23H20F3NO4S/c24-23(25,26)31-18-11-9-15(10-12-18)17-13-20(32-14-17)22(30)27-19(7-4-8-21(28)29)16-5-2-1-3-6-16/h1-3,5-6,9-14,19H,4,7-8H2,(H,27,30)(H,28,29) |
| InChIKey | CHFHBWOGRXDYPA-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.48 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |