C51H38BrF3N2O6 — CID 87878319
[3-[(3-bromobenzoyl)amino]-3-(4-phenylphenyl)propanoyl] 3-(4-phenylphenyl)-3-[[4-[4-(trifluoromethoxy)phenyl]benzoyl]amino]propanoate (PubChem CID 87878319) has the molecular formula C51H38BrF3N2O6 and a molecular weight of 911.77 g/mol. Its IUPAC name is [3-[(3-bromobenzoyl)amino]-3-(4-phenylphenyl)propanoyl] 3-(4-phenylphenyl)-3-[[4-[4-(trifluoromethoxy)phenyl]benzoyl]amino]propanoate.
| Compound Name | [3-[(3-bromobenzoyl)amino]-3-(4-phenylphenyl)propanoyl] 3-(4-phenylphenyl)-3-[[4-[4-(trifluoromethoxy)phenyl]benzoyl]amino]propanoate |
|---|---|
| PubChem CID | 87878319 |
| Molecular Formula | C51H38BrF3N2O6 |
| Molecular Weight | 911.77 g/mol |
| Exact Mass | 910.19 |
| IUPAC Name | [3-[(3-bromobenzoyl)amino]-3-(4-phenylphenyl)propanoyl] 3-(4-phenylphenyl)-3-[[4-[4-(trifluoromethoxy)phenyl]benzoyl]amino]propanoate |
| SMILES | O=C(CC(NC(=O)c1ccc(-c2ccc(OC(F)(F)F)cc2)cc1)c1ccc(-c2ccccc2)cc1)OC(=O)CC(NC(=O)c1cccc(Br)c1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C51H38BrF3N2O6/c52-43-13-7-12-42(30-43)50(61)57-46(40-22-16-36(17-23-40)34-10-5-2-6-11-34)32-48(59)62-47(58)31-45(39-20-14-35(15-21-39)33-8-3-1-4-9-33)56-49(60)41-24-18-37(19-25-41)38-26-28-44(29-27-38)63-51(53,54)55/h1-30,45-46H,31-32H2,(H,56,60)(H,57,61) |
| InChIKey | BVEOXHWRUYGAFM-UHFFFAOYSA-N |
| XLogP | 11.84 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 911.77 |
| LogP ≤ 5 | 11.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|