C23H21BrN2O3 — CID 68860273
methyl 3-[(2-amino-5-bromobenzoyl)amino]-3-(4-phenylphenyl)propanoate (PubChem CID 68860273) has the molecular formula C23H21BrN2O3 and a molecular weight of 453.34 g/mol. Its IUPAC name is methyl 3-[(2-amino-5-bromobenzoyl)amino]-3-(4-phenylphenyl)propanoate.
| Compound Name | methyl 3-[(2-amino-5-bromobenzoyl)amino]-3-(4-phenylphenyl)propanoate |
|---|---|
| PubChem CID | 68860273 |
| Molecular Formula | C23H21BrN2O3 |
| Molecular Weight | 453.34 g/mol |
| Exact Mass | 452.07 |
| IUPAC Name | methyl 3-[(2-amino-5-bromobenzoyl)amino]-3-(4-phenylphenyl)propanoate |
| SMILES | COC(=O)CC(NC(=O)c1cc(Br)ccc1N)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H21BrN2O3/c1-29-22(27)14-21(26-23(28)19-13-18(24)11-12-20(19)25)17-9-7-16(8-10-17)15-5-3-2-4-6-15/h2-13,21H,14,25H2,1H3,(H,26,28) |
| InChIKey | UNRHMVUINXTDBG-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.34 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|