C22H18F3NO4S — CID 10049366
ethyl 4-[[[4-[4-(trifluoromethoxy)phenyl]thiophene-2-carbonyl]amino]methyl]benzoate (PubChem CID 10049366) has the molecular formula C22H18F3NO4S and a molecular weight of 449.45 g/mol. Its IUPAC name is ethyl 4-[[[4-[4-(trifluoromethoxy)phenyl]thiophene-2-carbonyl]amino]methyl]benzoate.
| Compound Name | ethyl 4-[[[4-[4-(trifluoromethoxy)phenyl]thiophene-2-carbonyl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 10049366 |
| Molecular Formula | C22H18F3NO4S |
| Molecular Weight | 449.45 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | ethyl 4-[[[4-[4-(trifluoromethoxy)phenyl]thiophene-2-carbonyl]amino]methyl]benzoate |
| SMILES | CCOC(=O)c1ccc(CNC(=O)c2cc(-c3ccc(OC(F)(F)F)cc3)cs2)cc1 |
| InChI | InChI=1S/C22H18F3NO4S/c1-2-29-21(28)16-5-3-14(4-6-16)12-26-20(27)19-11-17(13-31-19)15-7-9-18(10-8-15)30-22(23,24)25/h3-11,13H,2,12H2,1H3,(H,26,27) |
| InChIKey | AUTXWNIOTGFOKA-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.45 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |