C21H24F3NO4S — CID 10094930
ethyl 7-[[4-[4-(trifluoromethoxy)phenyl]thiophene-2-carbonyl]amino]heptanoate (PubChem CID 10094930) has the molecular formula C21H24F3NO4S and a molecular weight of 443.49 g/mol. Its IUPAC name is ethyl 7-[[4-[4-(trifluoromethoxy)phenyl]thiophene-2-carbonyl]amino]heptanoate.
| Compound Name | ethyl 7-[[4-[4-(trifluoromethoxy)phenyl]thiophene-2-carbonyl]amino]heptanoate |
|---|---|
| PubChem CID | 10094930 |
| Molecular Formula | C21H24F3NO4S |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | ethyl 7-[[4-[4-(trifluoromethoxy)phenyl]thiophene-2-carbonyl]amino]heptanoate |
| SMILES | CCOC(=O)CCCCCCNC(=O)c1cc(-c2ccc(OC(F)(F)F)cc2)cs1 |
| InChI | InChI=1S/C21H24F3NO4S/c1-2-28-19(26)7-5-3-4-6-12-25-20(27)18-13-16(14-30-18)15-8-10-17(11-9-15)29-21(22,23)24/h8-11,13-14H,2-7,12H2,1H3,(H,25,27) |
| InChIKey | GLUYQUOPQBVWJX-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|