C16H17F3N2O2S2 — CID 162579532
N-(3-methylsulfinylpropyl)-4-[4-(trifluoromethylamino)phenyl]thiophene-2-carboxamide (PubChem CID 162579532) has the molecular formula C16H17F3N2O2S2 and a molecular weight of 390.45 g/mol. Its IUPAC name is N-(3-methylsulfinylpropyl)-4-[4-(trifluoromethylamino)phenyl]thiophene-2-carboxamide.
| Compound Name | N-(3-methylsulfinylpropyl)-4-[4-(trifluoromethylamino)phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 162579532 |
| Molecular Formula | C16H17F3N2O2S2 |
| Molecular Weight | 390.45 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | N-(3-methylsulfinylpropyl)-4-[4-(trifluoromethylamino)phenyl]thiophene-2-carboxamide |
| SMILES | CS(=O)CCCNC(=O)c1cc(-c2ccc(NC(F)(F)F)cc2)cs1 |
| InChI | InChI=1S/C16H17F3N2O2S2/c1-25(23)8-2-7-20-15(22)14-9-12(10-24-14)11-3-5-13(6-4-11)21-16(17,18)19/h3-6,9-10,21H,2,7-8H2,1H3,(H,20,22) |
| InChIKey | HWFPLQCKGQRKOG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|