C20H22BrF3N4O5 — CID 87924732
ethyl 6-[[3-[bromo-[4-(trifluoromethoxy)phenyl]carbamoyl]pyrazole-1-carbonyl]amino]hexanoate (PubChem CID 87924732) has the molecular formula C20H22BrF3N4O5 and a molecular weight of 535.32 g/mol. Its IUPAC name is ethyl 6-[[3-[bromo-[4-(trifluoromethoxy)phenyl]carbamoyl]pyrazole-1-carbonyl]amino]hexanoate.
| Compound Name | ethyl 6-[[3-[bromo-[4-(trifluoromethoxy)phenyl]carbamoyl]pyrazole-1-carbonyl]amino]hexanoate |
|---|---|
| PubChem CID | 87924732 |
| Molecular Formula | C20H22BrF3N4O5 |
| Molecular Weight | 535.32 g/mol |
| Exact Mass | 534.07 |
| IUPAC Name | ethyl 6-[[3-[bromo-[4-(trifluoromethoxy)phenyl]carbamoyl]pyrazole-1-carbonyl]amino]hexanoate |
| SMILES | CCOC(=O)CCCCCNC(=O)n1ccc(C(=O)N(Br)c2ccc(OC(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C20H22BrF3N4O5/c1-2-32-17(29)6-4-3-5-12-25-19(31)27-13-11-16(26-27)18(30)28(21)14-7-9-15(10-8-14)33-20(22,23)24/h7-11,13H,2-6,12H2,1H3,(H,25,31) |
| InChIKey | QTHUBGASKBUYRS-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 102.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.32 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|