C29H30F3N3O5 — CID 86622230
(2S)-5-(1-aminoethylideneamino)-2-[(3-benzhydrylbenzoyl)amino]pentanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 86622230) has the molecular formula C29H30F3N3O5 and a molecular weight of 557.57 g/mol. Its IUPAC name is (2S)-5-(1-aminoethylideneamino)-2-[(3-benzhydrylbenzoyl)amino]pentanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-5-(1-aminoethylideneamino)-2-[(3-benzhydrylbenzoyl)amino]pentanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 86622230 |
| Molecular Formula | C29H30F3N3O5 |
| Molecular Weight | 557.57 g/mol |
| Exact Mass | 557.21 |
| IUPAC Name | (2S)-5-(1-aminoethylideneamino)-2-[(3-benzhydrylbenzoyl)amino]pentanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | C/C(N)=N\CCC[C@H](NC(=O)c1cccc(C(c2ccccc2)c2ccccc2)c1)C(=O)O.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C27H29N3O3.C2HF3O2/c1-19(28)29-17-9-16-24(27(32)33)30-26(31)23-15-8-14-22(18-23)25(20-10-4-2-5-11-20)21-12-6-3-7-13-21;3-2(4,5)1(6)7/h2-8,10-15,18,24-25H,9,16-17H2,1H3,(H2,28,29)(H,30,31)(H,32,33);(H,6,7)/t24-;/m0./s1 |
| InChIKey | ZXFUAFRERPBUBC-JIDHJSLPSA-N |
| XLogP | 4.84 |
| TPSA | 142.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.57 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|