C27H27N3O — CID 143076239
2,4-diphenyl-N-(1-phenylpentyl)-1H-imidazole-5-carboxamide (PubChem CID 143076239) has the molecular formula C27H27N3O and a molecular weight of 409.53 g/mol. Its IUPAC name is 2,4-diphenyl-N-(1-phenylpentyl)-1H-imidazole-5-carboxamide.
| Compound Name | 2,4-diphenyl-N-(1-phenylpentyl)-1H-imidazole-5-carboxamide |
|---|---|
| PubChem CID | 143076239 |
| Molecular Formula | C27H27N3O |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.22 |
| IUPAC Name | 2,4-diphenyl-N-(1-phenylpentyl)-1H-imidazole-5-carboxamide |
| SMILES | CCCCC(NC(=O)c1[nH]c(-c2ccccc2)nc1-c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H27N3O/c1-2-3-19-23(20-13-7-4-8-14-20)28-27(31)25-24(21-15-9-5-10-16-21)29-26(30-25)22-17-11-6-12-18-22/h4-18,23H,2-3,19H2,1H3,(H,28,31)(H,29,30) |
| InChIKey | MSRNYXMVNXAVAT-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |