C20H20N2O6S2 — CID 140977683
2-[[2-[(2-carbamoylphenyl)disulfanyl]benzoyl]amino]hexanedioic acid (PubChem CID 140977683) has the molecular formula C20H20N2O6S2 and a molecular weight of 448.52 g/mol. Its IUPAC name is 2-[[2-[(2-carbamoylphenyl)disulfanyl]benzoyl]amino]hexanedioic acid.
| Compound Name | 2-[[2-[(2-carbamoylphenyl)disulfanyl]benzoyl]amino]hexanedioic acid |
|---|---|
| PubChem CID | 140977683 |
| Molecular Formula | C20H20N2O6S2 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | 2-[[2-[(2-carbamoylphenyl)disulfanyl]benzoyl]amino]hexanedioic acid |
| SMILES | NC(=O)c1ccccc1SSc1ccccc1C(=O)NC(CCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H20N2O6S2/c21-18(25)12-6-1-3-9-15(12)29-30-16-10-4-2-7-13(16)19(26)22-14(20(27)28)8-5-11-17(23)24/h1-4,6-7,9-10,14H,5,8,11H2,(H2,21,25)(H,22,26)(H,23,24)(H,27,28) |
| InChIKey | NYDUOPKPNRJYAM-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 146.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|