C9H11NO6-2 — CID 25244043
(2S)-2-(3-carboxylatopropanoylamino)-5-oxopentanoate (PubChem CID 25244043) has the molecular formula C9H11NO6-2 and a molecular weight of 229.19 g/mol. Its IUPAC name is (2S)-2-(3-carboxylatopropanoylamino)-5-oxopentanoate.
| Compound Name | (2S)-2-(3-carboxylatopropanoylamino)-5-oxopentanoate |
|---|---|
| PubChem CID | 25244043 |
| Molecular Formula | C9H11NO6-2 |
| Molecular Weight | 229.19 g/mol |
| Exact Mass | 229.06 |
| IUPAC Name | (2S)-2-(3-carboxylatopropanoylamino)-5-oxopentanoate |
| SMILES | O=CCC[C@H](NC(=O)CCC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C9H13NO6/c11-5-1-2-6(9(15)16)10-7(12)3-4-8(13)14/h5-6H,1-4H2,(H,10,12)(H,13,14)(H,15,16)/p-2/t6-/m0/s1 |
| InChIKey | XTOKIEIBKARFSZ-LURJTMIESA-L |
| XLogP | -3.27 |
| TPSA | 126.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.19 |
| LogP ≤ 5 | -3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|