2-(butanoylamino)-5-oxopentanoic acid

C9H15NO4 — CID 123955857

IUPAC2-(butanoylamino)-5-oxopentanoic acid
SMILESCCCC(=O)NC(CCC=O)C(=O)O
InChIInChI=1S/C9H15NO4/c1-2-4-8(12)10-7(9(13)14)5-3-6-11/h6-7H,2-5H2,1H3,(H,10,12)(H,13,14)
InChIKeyGRIHHSBEIOAASZ-UHFFFAOYSA-N
MW201.22 g/mol
LogP0.34
Rot. Bonds7

About 2-(butanoylamino)-5-oxopentanoic acid

2-(butanoylamino)-5-oxopentanoic acid (PubChem CID 123955857) has the molecular formula C9H15NO4 and a molecular weight of 201.22 g/mol. Its IUPAC name is 2-(butanoylamino)-5-oxopentanoic acid.

Molecular Properties

Compound Name2-(butanoylamino)-5-oxopentanoic acid
PubChem CID123955857
Molecular FormulaC9H15NO4
Molecular Weight201.22 g/mol
Exact Mass201.10
IUPAC Name2-(butanoylamino)-5-oxopentanoic acid
SMILESCCCC(=O)NC(CCC=O)C(=O)O
InChIInChI=1S/C9H15NO4/c1-2-4-8(12)10-7(9(13)14)5-3-6-11/h6-7H,2-5H2,1H3,(H,10,12)(H,13,14)
InChIKeyGRIHHSBEIOAASZ-UHFFFAOYSA-N
XLogP0.34
TPSA83.47 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500201.22
LogP ≤ 50.34
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze 2-(butanoylamino)-5-oxopentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(2S)-2-(butanoylamino)-5-oxopentanoic acid
CID 174872507
(2R)-2-(butanoylamino)pentanoic acid
CID 107562849
(2S)-2-acetamido-5-[[(1S)-1-carboxy-4-[[(1S)-1-carboxy-4-[[(1S)-1-carboxy-4-oxobutyl]amino]-4-oxobutyl]amino]-4-oxobutyl]amino]-5-oxopentanoic acid
CID 134482695
2-(18-oxooctadecanoylamino)pentanoic acid
CID 123209154
(2S)-2-(butanoylamino)-4-methylselanylbutanoic acid
CID 89313972
4-formamido-2-(pentanoylamino)butanoic acid
CID 57320299
(2S)-2-(hexanoylamino)hexanoic acid
CID 22214794
(2R)-7-amino-2-(butanoylamino)oct-7-enoic acid
CID 59958595
(2R)-2-[[(E)-3-ethylhept-4-enoyl]amino]-5-oxopentanoic acid
CID 173343908
2-(butanoylamino)butanedioic acid;zinc
CID 174973870
(2S)-4-hydroxy-2-(7-oxoheptanoylamino)butanoic acid
CID 91574406
sodium;2-(butanoylamino)butanedioic acid;hydride
CID 174974631

Frequently Asked Questions

What is the IUPAC name of 2-(butanoylamino)-5-oxopentanoic acid?
The IUPAC name of 2-(butanoylamino)-5-oxopentanoic acid (CID 123955857) is 2-(butanoylamino)-5-oxopentanoic acid.
What is the SMILES notation for 2-(butanoylamino)-5-oxopentanoic acid?
The canonical SMILES for 2-(butanoylamino)-5-oxopentanoic acid is CCCC(=O)NC(CCC=O)C(=O)O.
What is the InChIKey of 2-(butanoylamino)-5-oxopentanoic acid?
The InChIKey is GRIHHSBEIOAASZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15NO4/c1-2-4-8(12)10-7(9(13)14)5-3-6-11/h6-7H,2-5H2,1H3,(H,10,12)(H,13,14).
What are the key properties of 2-(butanoylamino)-5-oxopentanoic acid?
2-(butanoylamino)-5-oxopentanoic acid has a molecular weight of 201.22 g/mol, XLogP of 0.34, 7 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(butanoylamino)-5-oxopentanoic acid is sourced from PubChem (CID 123955857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).