C14H23NO4 — CID 173343908
(2R)-2-[[(E)-3-ethylhept-4-enoyl]amino]-5-oxopentanoic acid (PubChem CID 173343908) has the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. Its IUPAC name is (2R)-2-[[(E)-3-ethylhept-4-enoyl]amino]-5-oxopentanoic acid.
| Compound Name | (2R)-2-[[(E)-3-ethylhept-4-enoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 173343908 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | (2R)-2-[[(E)-3-ethylhept-4-enoyl]amino]-5-oxopentanoic acid |
| SMILES | CC/C=C/C(CC)CC(=O)N[C@H](CCC=O)C(=O)O |
| InChI | InChI=1S/C14H23NO4/c1-3-5-7-11(4-2)10-13(17)15-12(14(18)19)8-6-9-16/h5,7,9,11-12H,3-4,6,8,10H2,1-2H3,(H,15,17)(H,18,19)/b7-5+/t11?,12-/m1/s1 |
| InChIKey | NGHHMUZCKPPPLT-ROLHCCBCSA-N |
| XLogP | 1.92 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|