C5H6CaN2O5 — CID 156759447
calcium 2-(carbamoylamino)butanedioate (PubChem CID 156759447) has the molecular formula C5H6CaN2O5 and a molecular weight of 214.19 g/mol. Its IUPAC name is calcium 2-(carbamoylamino)butanedioate.
| Compound Name | calcium 2-(carbamoylamino)butanedioate |
|---|---|
| PubChem CID | 156759447 |
| Molecular Formula | C5H6CaN2O5 |
| Molecular Weight | 214.19 g/mol |
| Exact Mass | 213.99 |
| IUPAC Name | calcium 2-(carbamoylamino)butanedioate |
| SMILES | NC(=O)NC(CC(=O)[O-])C(=O)[O-].[Ca+2] |
| InChI | InChI=1S/C5H8N2O5.Ca/c6-5(12)7-2(4(10)11)1-3(8)9;/h2H,1H2,(H,8,9)(H,10,11)(H3,6,7,12);/q;+2/p-2 |
| InChIKey | KGWAITXYALRFDQ-UHFFFAOYSA-L |
| XLogP | -4.47 |
| TPSA | 135.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.19 |
| LogP ≤ 5 | -4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |