C8H7Co2NO8 — CID 175697407
bis(cobalt(2+));2-(1,2-dicarboxylatoethylamino)butanedioate (PubChem CID 175697407) has the molecular formula C8H7Co2NO8 and a molecular weight of 363.01 g/mol. Its IUPAC name is bis(cobalt(2+));2-(1,2-dicarboxylatoethylamino)butanedioate.
| Compound Name | bis(cobalt(2+));2-(1,2-dicarboxylatoethylamino)butanedioate |
|---|---|
| PubChem CID | 175697407 |
| Molecular Formula | C8H7Co2NO8 |
| Molecular Weight | 363.01 g/mol |
| Exact Mass | 362.88 |
| IUPAC Name | bis(cobalt(2+));2-(1,2-dicarboxylatoethylamino)butanedioate |
| SMILES | O=C([O-])CC(NC(CC(=O)[O-])C(=O)[O-])C(=O)[O-].[Co+2].[Co+2] |
| InChI | InChI=1S/C8H11NO8.2Co/c10-5(11)1-3(7(14)15)9-4(8(16)17)2-6(12)13;;/h3-4,9H,1-2H2,(H,10,11)(H,12,13)(H,14,15)(H,16,17);;/q;2*+2/p-4 |
| InChIKey | LXULAEWOBDQABW-UHFFFAOYSA-J |
| XLogP | -6.91 |
| TPSA | 172.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.01 |
| LogP ≤ 5 | -6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |